C32H31F3N3S3+ — CID 156665374
7-(4-tert-butyl-1-methylnaphthalen-2-yl)-6-methyl-3-[2-(3,3,3-trifluoro-2,2-dimethylpropyl)-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thieno[2,3-c]pyridin-6-ium (PubChem CID 156665374) has the molecular formula C32H31F3N3S3+ and a molecular weight of 610.82 g/mol. Its IUPAC name is 7-(4-tert-butyl-1-methylnaphthalen-2-yl)-6-methyl-3-[2-(3,3,3-trifluoro-2,2-dimethylpropyl)-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thieno[2,3-c]pyridin-6-ium.
| Compound Name | 7-(4-tert-butyl-1-methylnaphthalen-2-yl)-6-methyl-3-[2-(3,3,3-trifluoro-2,2-dimethylpropyl)-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thieno[2,3-c]pyridin-6-ium |
|---|---|
| PubChem CID | 156665374 |
| Molecular Formula | C32H31F3N3S3+ |
| Molecular Weight | 610.82 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | 7-(4-tert-butyl-1-methylnaphthalen-2-yl)-6-methyl-3-[2-(3,3,3-trifluoro-2,2-dimethylpropyl)-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thieno[2,3-c]pyridin-6-ium |
| SMILES | Cc1c(-c2c3scc(-c4nc5sc(CC(C)(C)C(F)(F)F)nc5s4)c3cc[n+]2C)cc(C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C32H31F3N3S3/c1-17-18-10-8-9-11-19(18)23(30(2,3)4)14-21(17)25-26-20(12-13-38(25)7)22(16-39-26)27-37-29-28(41-27)36-24(40-29)15-31(5,6)32(33,34)35/h8-14,16H,15H2,1-7H3/q+1 |
| InChIKey | JJMQCFAAPYRRHI-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.82 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|