About tert-butyl-[[3-(4,5-dihydro-1H-pyrazol-5-yl)-2-fluorophenyl]methoxy]-dimethylsilane
tert-butyl-[[3-(4,5-dihydro-1H-pyrazol-5-yl)-2-fluorophenyl]methoxy]-dimethylsilane (PubChem CID 156665642) has the molecular formula C16H25FN2OSi
and a molecular weight of 308.47 g/mol. Its IUPAC name is tert-butyl-[[3-(4,5-dihydro-1H-pyrazol-5-yl)-2-fluorophenyl]methoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[[3-(4,5-dihydro-1H-pyrazol-5-yl)-2-fluorophenyl]methoxy]-dimethylsilane |
| PubChem CID | 156665642 |
| Molecular Formula | C16H25FN2OSi |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | tert-butyl-[[3-(4,5-dihydro-1H-pyrazol-5-yl)-2-fluorophenyl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc(C2CC=NN2)c1F |
| InChI | InChI=1S/C16H25FN2OSi/c1-16(2,3)21(4,5)20-11-12-7-6-8-13(15(12)17)14-9-10-18-19-14/h6-8,10,14,19H,9,11H2,1-5H3 |
| InChIKey | ZPNHXSZPQZHFTH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[[3-(4,5-dihydro-1H-pyrazol-5-yl)-2-fluorophenyl]methoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[[3-(4,5-dihydro-1H-pyrazol-5-yl)-2-fluorophenyl]methoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[[3-(4,5-dihydro-1H-pyrazol-5-yl)-2-fluorophenyl]methoxy]-dimethylsilane (CID 156665642) is tert-butyl-[[3-(4,5-dihydro-1H-pyrazol-5-yl)-2-fluorophenyl]methoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[[3-(4,5-dihydro-1H-pyrazol-5-yl)-2-fluorophenyl]methoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[[3-(4,5-dihydro-1H-pyrazol-5-yl)-2-fluorophenyl]methoxy]-dimethylsilane is CC(C)(C)[Si](C)(C)OCc1cccc(C2CC=NN2)c1F.
What is the InChIKey of tert-butyl-[[3-(4,5-dihydro-1H-pyrazol-5-yl)-2-fluorophenyl]methoxy]-dimethylsilane?
The InChIKey is ZPNHXSZPQZHFTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25FN2OSi/c1-16(2,3)21(4,5)20-11-12-7-6-8-13(15(12)17)14-9-10-18-19-14/h6-8,10,14,19H,9,11H2,1-5H3.
What are the key properties of tert-butyl-[[3-(4,5-dihydro-1H-pyrazol-5-yl)-2-fluorophenyl]methoxy]-dimethylsilane?
tert-butyl-[[3-(4,5-dihydro-1H-pyrazol-5-yl)-2-fluorophenyl]methoxy]-dimethylsilane has a molecular weight of 308.47 g/mol, XLogP of 4.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[[3-(4,5-dihydro-1H-pyrazol-5-yl)-2-fluorophenyl]methoxy]-dimethylsilane is sourced from PubChem (CID 156665642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).