C16H12BrFKN2O2- — CID 156666101
potassium;[2-(4-bromo-2-fluorophenyl)-7-ethylpyrazolo[1,5-a]pyridin-5-yl]methanone;hydroxide (PubChem CID 156666101) has the molecular formula C16H12BrFKN2O2- and a molecular weight of 402.28 g/mol. Its IUPAC name is potassium;[2-(4-bromo-2-fluorophenyl)-7-ethylpyrazolo[1,5-a]pyridin-5-yl]methanone;hydroxide.
| Compound Name | potassium;[2-(4-bromo-2-fluorophenyl)-7-ethylpyrazolo[1,5-a]pyridin-5-yl]methanone;hydroxide |
|---|---|
| PubChem CID | 156666101 |
| Molecular Formula | C16H12BrFKN2O2- |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | potassium;[2-(4-bromo-2-fluorophenyl)-7-ethylpyrazolo[1,5-a]pyridin-5-yl]methanone;hydroxide |
| SMILES | CCc1cc([C-]=O)cc2cc(-c3ccc(Br)cc3F)nn12.[K+].[OH-] |
| InChI | InChI=1S/C16H11BrFN2O.K.H2O/c1-2-12-5-10(9-21)6-13-8-16(19-20(12)13)14-4-3-11(17)7-15(14)18;;/h3-8H,2H2,1H3;;1H2/q-1;+1;/p-1 |
| InChIKey | VVVBSLXSQMTIRC-UHFFFAOYSA-M |
| XLogP | 0.75 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|