C13H15Br3O6S — CID 156666338
2-[2-[(2,4,6-tribromo-3-hydroxyphenyl)methyl]butanoyloxy]ethanesulfonic acid (PubChem CID 156666338) has the molecular formula C13H15Br3O6S and a molecular weight of 539.04 g/mol. Its IUPAC name is 2-[2-[(2,4,6-tribromo-3-hydroxyphenyl)methyl]butanoyloxy]ethanesulfonic acid.
| Compound Name | 2-[2-[(2,4,6-tribromo-3-hydroxyphenyl)methyl]butanoyloxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 156666338 |
| Molecular Formula | C13H15Br3O6S |
| Molecular Weight | 539.04 g/mol |
| Exact Mass | 535.81 |
| IUPAC Name | 2-[2-[(2,4,6-tribromo-3-hydroxyphenyl)methyl]butanoyloxy]ethanesulfonic acid |
| SMILES | CCC(Cc1c(Br)cc(Br)c(O)c1Br)C(=O)OCCS(=O)(=O)O |
| InChI | InChI=1S/C13H15Br3O6S/c1-2-7(13(18)22-3-4-23(19,20)21)5-8-9(14)6-10(15)12(17)11(8)16/h6-7,17H,2-5H2,1H3,(H,19,20,21) |
| InChIKey | VVEVHYHQYJIPDV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.04 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|