C13H2Br3F4O5S- — CID 156666411
2,3,5,6-tetrafluoro-4-(2,4,6-tribromobenzoyl)oxybenzenesulfonate (PubChem CID 156666411) has the molecular formula C13H2Br3F4O5S- and a molecular weight of 585.93 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,4,6-tribromobenzoyl)oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,4,6-tribromobenzoyl)oxybenzenesulfonate |
|---|---|
| PubChem CID | 156666411 |
| Molecular Formula | C13H2Br3F4O5S- |
| Molecular Weight | 585.93 g/mol |
| Exact Mass | 582.71 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,4,6-tribromobenzoyl)oxybenzenesulfonate |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F)c1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C13H3Br3F4O5S/c14-3-1-4(15)6(5(16)2-3)13(21)25-11-7(17)9(19)12(26(22,23)24)10(20)8(11)18/h1-2H,(H,22,23,24)/p-1 |
| InChIKey | FVWXKTBXNXTREE-UHFFFAOYSA-M |
| XLogP | 4.65 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.93 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|