C22H21F2N7O2 — CID 156666525
3-[6-[[[(2E)-2-[2-amino-6-(2,3-difluorophenyl)pyrimidin-4-yl]-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]butanoic acid (PubChem CID 156666525) has the molecular formula C22H21F2N7O2 and a molecular weight of 453.45 g/mol. Its IUPAC name is 3-[6-[[[(2E)-2-[2-amino-6-(2,3-difluorophenyl)pyrimidin-4-yl]-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]butanoic acid.
| Compound Name | 3-[6-[[[(2E)-2-[2-amino-6-(2,3-difluorophenyl)pyrimidin-4-yl]-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]butanoic acid |
|---|---|
| PubChem CID | 156666525 |
| Molecular Formula | C22H21F2N7O2 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 3-[6-[[[(2E)-2-[2-amino-6-(2,3-difluorophenyl)pyrimidin-4-yl]-2-hydrazinylideneethylidene]amino]methyl]-2-pyridinyl]butanoic acid |
| SMILES | CC(CC(=O)O)c1cccc(C/N=C/C(=N\N)c2cc(-c3cccc(F)c3F)nc(N)n2)n1 |
| InChI | InChI=1S/C22H21F2N7O2/c1-12(8-20(32)33)16-7-2-4-13(28-16)10-27-11-19(31-26)18-9-17(29-22(25)30-18)14-5-3-6-15(23)21(14)24/h2-7,9,11-12H,8,10,26H2,1H3,(H,32,33)(H2,25,29,30)/b27-11+,31-19+ |
| InChIKey | WPUKGYQTHKTHPB-NNJMZWDWSA-N |
| XLogP | 2.91 |
| TPSA | 152.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|