C17H14F3NO5 — CID 156667005
8-(3,3-dihydroxypropyl)-3-(trifluoromethoxy)-5H-benzo[b][1,4]benzoxazepin-6-one (PubChem CID 156667005) has the molecular formula C17H14F3NO5 and a molecular weight of 369.30 g/mol. Its IUPAC name is 8-(3,3-dihydroxypropyl)-3-(trifluoromethoxy)-5H-benzo[b][1,4]benzoxazepin-6-one.
| Compound Name | 8-(3,3-dihydroxypropyl)-3-(trifluoromethoxy)-5H-benzo[b][1,4]benzoxazepin-6-one |
|---|---|
| PubChem CID | 156667005 |
| Molecular Formula | C17H14F3NO5 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 8-(3,3-dihydroxypropyl)-3-(trifluoromethoxy)-5H-benzo[b][1,4]benzoxazepin-6-one |
| SMILES | O=C1Nc2cc(OC(F)(F)F)ccc2Oc2ccc(CCC(O)O)cc21 |
| InChI | InChI=1S/C17H14F3NO5/c18-17(19,20)26-10-3-5-14-12(8-10)21-16(24)11-7-9(2-6-15(22)23)1-4-13(11)25-14/h1,3-5,7-8,15,22-23H,2,6H2,(H,21,24) |
| InChIKey | AYPRWODBJYOOOA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|