C41H53IrN2O2- — CID 156667260
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;7-(3,5-dimethylbenzene-6-id-1-yl)-4-(4,4-dimethylcyclohexyl)-1,8-phenanthroline;iridium (PubChem CID 156667260) has the molecular formula C41H53IrN2O2- and a molecular weight of 798.10 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;7-(3,5-dimethylbenzene-6-id-1-yl)-4-(4,4-dimethylcyclohexyl)-1,8-phenanthroline;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;7-(3,5-dimethylbenzene-6-id-1-yl)-4-(4,4-dimethylcyclohexyl)-1,8-phenanthroline;iridium |
|---|---|
| PubChem CID | 156667260 |
| Molecular Formula | C41H53IrN2O2- |
| Molecular Weight | 798.10 g/mol |
| Exact Mass | 798.37 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;7-(3,5-dimethylbenzene-6-id-1-yl)-4-(4,4-dimethylcyclohexyl)-1,8-phenanthroline;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1[c-]c(-c2nccc3c2ccc2c(C4CCC(C)(C)CC4)ccnc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C28H29N2.C13H24O2.Ir/c1-18-15-19(2)17-21(16-18)26-24-6-5-23-22(20-7-11-28(3,4)12-8-20)9-13-30-27(23)25(24)10-14-29-26;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-6,9-10,13-16,20H,7-8,11-12H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | FAQSQKTVLBTADV-DZTQYQPZSA-N |
| XLogP | 11.42 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.10 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|