C44H39F3IrN4OSi-2 — CID 156667891
8-(1-benzylbenzimidazol-2-yl)-2-(trifluoromethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 156667891) has the molecular formula C44H39F3IrN4OSi-2 and a molecular weight of 917.12 g/mol. Its IUPAC name is 8-(1-benzylbenzimidazol-2-yl)-2-(trifluoromethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | 8-(1-benzylbenzimidazol-2-yl)-2-(trifluoromethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 156667891 |
| Molecular Formula | C44H39F3IrN4OSi-2 |
| Molecular Weight | 917.12 g/mol |
| Exact Mass | 917.25 |
| IUPAC Name | 8-(1-benzylbenzimidazol-2-yl)-2-(trifluoromethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.FC(F)(F)c1ccc2c(n1)oc1c(-c3nc4ccccc4n3Cc3ccccc3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C26H15F3N3O.C18H24NSi.Ir/c27-26(28,29)22-14-13-18-17-9-6-10-19(23(17)33-25(18)31-22)24-30-20-11-4-5-12-21(20)32(24)15-16-7-2-1-3-8-16;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h1-9,11-14H,15H2;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | IMATTYONXABSCC-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.12 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|