C40H42IrN4OSi-2 — CID 156668291
iridium;8-(1-methylbenzimidazol-2-yl)-2-propan-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 156668291) has the molecular formula C40H42IrN4OSi-2 and a molecular weight of 815.11 g/mol. Its IUPAC name is iridium;8-(1-methylbenzimidazol-2-yl)-2-propan-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | iridium;8-(1-methylbenzimidazol-2-yl)-2-propan-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 156668291 |
| Molecular Formula | C40H42IrN4OSi-2 |
| Molecular Weight | 815.11 g/mol |
| Exact Mass | 815.28 |
| IUPAC Name | iridium;8-(1-methylbenzimidazol-2-yl)-2-propan-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.CC(C)c1ccc2c(n1)oc1c(-c3nc4ccccc4n3C)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C22H18N3O.C18H24NSi.Ir/c1-13(2)17-12-11-15-14-7-6-8-16(20(14)26-22(15)24-17)21-23-18-9-4-5-10-19(18)25(21)3;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h4-7,9-13H,1-3H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | SCINZUMMBMKNFL-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.11 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|