C36H30FN3O — CID 156668460
2-fluoro-8-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 156668460) has the molecular formula C36H30FN3O and a molecular weight of 539.65 g/mol. Its IUPAC name is 2-fluoro-8-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-fluoro-8-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 156668460 |
| Molecular Formula | C36H30FN3O |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 2-fluoro-8-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2cccc3c2oc2nc(F)ccc23)nc2ccccc21 |
| InChI | InChI=1S/C36H30FN3O/c1-21(2)28-19-24(23-11-6-5-7-12-23)20-29(22(3)4)33(28)40-31-16-9-8-15-30(31)38-35(40)27-14-10-13-25-26-17-18-32(37)39-36(26)41-34(25)27/h5-22H,1-4H3 |
| InChIKey | BFTFNDROGSWCCH-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|