About methyl 4-propanoylbenzoate
methyl 4-propanoylbenzoate (PubChem CID 15666905) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is methyl 4-propanoylbenzoate.
Molecular Properties
| Compound Name | methyl 4-propanoylbenzoate |
| PubChem CID | 15666905 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | methyl 4-propanoylbenzoate |
| SMILES | CCC(=O)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C11H12O3/c1-3-10(12)8-4-6-9(7-5-8)11(13)14-2/h4-7H,3H2,1-2H3 |
| InChIKey | HJFQWZCJVDZOOO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-propanoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-propanoylbenzoate?
The IUPAC name of methyl 4-propanoylbenzoate (CID 15666905) is methyl 4-propanoylbenzoate.
What is the SMILES notation for methyl 4-propanoylbenzoate?
The canonical SMILES for methyl 4-propanoylbenzoate is CCC(=O)c1ccc(C(=O)OC)cc1.
What is the InChIKey of methyl 4-propanoylbenzoate?
The InChIKey is HJFQWZCJVDZOOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c1-3-10(12)8-4-6-9(7-5-8)11(13)14-2/h4-7H,3H2,1-2H3.
What are the key properties of methyl 4-propanoylbenzoate?
methyl 4-propanoylbenzoate has a molecular weight of 192.21 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-propanoylbenzoate is sourced from PubChem (CID 15666905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).