C42H56N6O6 — CID 15666978
(1R,8S,11R,17S,20R,23S)-11,20-dibenzyl-23-[(2S)-butan-2-yl]-10-methyl-3,10,13,19,22,25-hexazatetracyclo[23.4.0.03,8.013,17]nonacosane-2,9,12,18,21,24-hexone (PubChem CID 15666978) has the molecular formula C42H56N6O6 and a molecular weight of 740.95 g/mol. Its IUPAC name is (1R,8S,11R,17S,20R,23S)-11,20-dibenzyl-23-[(2S)-butan-2-yl]-10-methyl-3,10,13,19,22,25-hexazatetracyclo[23.4.0.03,8.013,17]nonacosane-2,9,12,18,21,24-hexone.
| Compound Name | (1R,8S,11R,17S,20R,23S)-11,20-dibenzyl-23-[(2S)-butan-2-yl]-10-methyl-3,10,13,19,22,25-hexazatetracyclo[23.4.0.03,8.013,17]nonacosane-2,9,12,18,21,24-hexone |
|---|---|
| PubChem CID | 15666978 |
| Molecular Formula | C42H56N6O6 |
| Molecular Weight | 740.95 g/mol |
| Exact Mass | 740.43 |
| IUPAC Name | (1R,8S,11R,17S,20R,23S)-11,20-dibenzyl-23-[(2S)-butan-2-yl]-10-methyl-3,10,13,19,22,25-hexazatetracyclo[23.4.0.03,8.013,17]nonacosane-2,9,12,18,21,24-hexone |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](Cc2ccccc2)N(C)C(=O)[C@@H]2CCCCN2C(=O)[C@H]2CCCCN2C1=O |
| InChI | InChI=1S/C42H56N6O6/c1-4-28(2)36-42(54)48-24-14-12-21-34(48)40(52)47-23-13-11-20-33(47)39(51)45(3)35(27-30-18-9-6-10-19-30)41(53)46-25-15-22-32(46)38(50)43-31(37(49)44-36)26-29-16-7-5-8-17-29/h5-10,16-19,28,31-36H,4,11-15,20-27H2,1-3H3,(H,43,50)(H,44,49)/t28-,31+,32-,33-,34+,35+,36-/m0/s1 |
| InChIKey | MIAHOWFGIYZPJD-JNXKOWIVSA-N |
| XLogP | 3.08 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.95 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |