C42H36N3O+ — CID 156672166
10-[3-(4-tert-butyl-2-phenylphenyl)benzo[e]benzimidazol-2-yl]-1,2,3,4-tetrahydro-[1]benzofuro[3,2-c]quinolizin-12-ium (PubChem CID 156672166) has the molecular formula C42H36N3O+ and a molecular weight of 598.77 g/mol. Its IUPAC name is 10-[3-(4-tert-butyl-2-phenylphenyl)benzo[e]benzimidazol-2-yl]-1,2,3,4-tetrahydro-[1]benzofuro[3,2-c]quinolizin-12-ium.
| Compound Name | 10-[3-(4-tert-butyl-2-phenylphenyl)benzo[e]benzimidazol-2-yl]-1,2,3,4-tetrahydro-[1]benzofuro[3,2-c]quinolizin-12-ium |
|---|---|
| PubChem CID | 156672166 |
| Molecular Formula | C42H36N3O+ |
| Molecular Weight | 598.77 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | 10-[3-(4-tert-butyl-2-phenylphenyl)benzo[e]benzimidazol-2-yl]-1,2,3,4-tetrahydro-[1]benzofuro[3,2-c]quinolizin-12-ium |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3cccc4c3oc3c4ccc4[n+]3CCCC4)nc3c4ccccc4ccc32)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C42H36N3O/c1-42(2,3)29-20-24-36(35(26-29)27-12-5-4-6-13-27)45-37-23-19-28-14-7-8-16-31(28)38(37)43-40(45)34-18-11-17-32-33-22-21-30-15-9-10-25-44(30)41(33)46-39(32)34/h4-8,11-14,16-24,26H,9-10,15,25H2,1-3H3/q+1 |
| InChIKey | VJGYELLFJOXQSU-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.77 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|