C41H45GeIrN5O-2 — CID 156672240
[4-(2,2-dimethylbutyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium;2,3,5-trimethyl-8-(3-methylimidazo[4,5-c]pyridin-2-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide (PubChem CID 156672240) has the molecular formula C41H45GeIrN5O-2 and a molecular weight of 888.67 g/mol. Its IUPAC name is [4-(2,2-dimethylbutyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium;2,3,5-trimethyl-8-(3-methylimidazo[4,5-c]pyridin-2-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide.
| Compound Name | [4-(2,2-dimethylbutyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium;2,3,5-trimethyl-8-(3-methylimidazo[4,5-c]pyridin-2-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
|---|---|
| PubChem CID | 156672240 |
| Molecular Formula | C41H45GeIrN5O-2 |
| Molecular Weight | 888.67 g/mol |
| Exact Mass | 890.25 |
| IUPAC Name | [4-(2,2-dimethylbutyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium;2,3,5-trimethyl-8-(3-methylimidazo[4,5-c]pyridin-2-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
| SMILES | CCC(C)(C)Cc1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C.Cc1cc2c(nc1C)oc1c(-c3nc4ccncc4n3C)[c-]cc(C)c12.[Ir] |
| InChI | InChI=1S/C21H17N4O.C20H28GeN.Ir/c1-11-5-6-14(20-24-16-7-8-22-10-17(16)25(20)4)19-18(11)15-9-12(2)13(3)23-21(15)26-19;1-7-20(2,3)14-17-13-19(16-11-9-8-10-12-16)22-15-18(17)21(4,5)6;/h5,7-10H,1-4H3;8-11,13,15H,7,14H2,1-6H3;/q2*-1; |
| InChIKey | OODVACYRZFKBBP-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.67 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|