C15H26O4 — CID 156672430
1,3-dihydroxypropan-2-yl (3Z,6E)-dodeca-3,6-dienoate (PubChem CID 156672430) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl (3Z,6E)-dodeca-3,6-dienoate.
| Compound Name | 1,3-dihydroxypropan-2-yl (3Z,6E)-dodeca-3,6-dienoate |
|---|---|
| PubChem CID | 156672430 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl (3Z,6E)-dodeca-3,6-dienoate |
| SMILES | CCCCC/C=C/C/C=C\CC(=O)OC(CO)CO |
| InChI | InChI=1S/C15H26O4/c1-2-3-4-5-6-7-8-9-10-11-15(18)19-14(12-16)13-17/h6-7,9-10,14,16-17H,2-5,8,11-13H2,1H3/b7-6+,10-9- |
| InChIKey | HSLWDAPUHHSGTE-KQHSAVHASA-N |
| XLogP | 2.36 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|