About 5-(1,1-difluoro-2-methylpropyl)-3-methyl-1,3-thiazol-3-ium
5-(1,1-difluoro-2-methylpropyl)-3-methyl-1,3-thiazol-3-ium (PubChem CID 156672688) has the molecular formula C8H12F2NS+
and a molecular weight of 192.25 g/mol. Its IUPAC name is 5-(1,1-difluoro-2-methylpropyl)-3-methyl-1,3-thiazol-3-ium.
Molecular Properties
| Compound Name | 5-(1,1-difluoro-2-methylpropyl)-3-methyl-1,3-thiazol-3-ium |
| PubChem CID | 156672688 |
| Molecular Formula | C8H12F2NS+ |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 5-(1,1-difluoro-2-methylpropyl)-3-methyl-1,3-thiazol-3-ium |
| SMILES | CC(C)C(F)(F)c1c[n+](C)cs1 |
| InChI | InChI=1S/C8H12F2NS/c1-6(2)8(9,10)7-4-11(3)5-12-7/h4-6H,1-3H3/q+1 |
| InChIKey | CVBABVLGMOXCGK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,1-difluoro-2-methylpropyl)-3-methyl-1,3-thiazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,1-difluoro-2-methylpropyl)-3-methyl-1,3-thiazol-3-ium?
The IUPAC name of 5-(1,1-difluoro-2-methylpropyl)-3-methyl-1,3-thiazol-3-ium (CID 156672688) is 5-(1,1-difluoro-2-methylpropyl)-3-methyl-1,3-thiazol-3-ium.
What is the SMILES notation for 5-(1,1-difluoro-2-methylpropyl)-3-methyl-1,3-thiazol-3-ium?
The canonical SMILES for 5-(1,1-difluoro-2-methylpropyl)-3-methyl-1,3-thiazol-3-ium is CC(C)C(F)(F)c1c[n+](C)cs1.
What is the InChIKey of 5-(1,1-difluoro-2-methylpropyl)-3-methyl-1,3-thiazol-3-ium?
The InChIKey is CVBABVLGMOXCGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2NS/c1-6(2)8(9,10)7-4-11(3)5-12-7/h4-6H,1-3H3/q+1.
What are the key properties of 5-(1,1-difluoro-2-methylpropyl)-3-methyl-1,3-thiazol-3-ium?
5-(1,1-difluoro-2-methylpropyl)-3-methyl-1,3-thiazol-3-ium has a molecular weight of 192.25 g/mol, XLogP of 2.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-difluoro-2-methylpropyl)-3-methyl-1,3-thiazol-3-ium is sourced from PubChem (CID 156672688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).