C18H21N5O2 — CID 156672987
prop-2-ynyl N-[4-[(7-aminoquinoxalin-5-yl)amino]cyclohexyl]carbamate (PubChem CID 156672987) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is prop-2-ynyl N-[4-[(7-aminoquinoxalin-5-yl)amino]cyclohexyl]carbamate.
| Compound Name | prop-2-ynyl N-[4-[(7-aminoquinoxalin-5-yl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 156672987 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | prop-2-ynyl N-[4-[(7-aminoquinoxalin-5-yl)amino]cyclohexyl]carbamate |
| SMILES | C#CCOC(=O)NC1CCC(Nc2cc(N)cc3nccnc23)CC1 |
| InChI | InChI=1S/C18H21N5O2/c1-2-9-25-18(24)23-14-5-3-13(4-6-14)22-16-11-12(19)10-15-17(16)21-8-7-20-15/h1,7-8,10-11,13-14,22H,3-6,9,19H2,(H,23,24) |
| InChIKey | OIXMUFMPDXYDKY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|