C22H23N7O2 — CID 156673200
8-[4-[[6-methyl-5-(1,3,4-oxadiazol-2-yl)-2-pyridinyl]amino]cyclohexyl]oxyquinoxalin-6-amine (PubChem CID 156673200) has the molecular formula C22H23N7O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 8-[4-[[6-methyl-5-(1,3,4-oxadiazol-2-yl)-2-pyridinyl]amino]cyclohexyl]oxyquinoxalin-6-amine.
| Compound Name | 8-[4-[[6-methyl-5-(1,3,4-oxadiazol-2-yl)-2-pyridinyl]amino]cyclohexyl]oxyquinoxalin-6-amine |
|---|---|
| PubChem CID | 156673200 |
| Molecular Formula | C22H23N7O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 8-[4-[[6-methyl-5-(1,3,4-oxadiazol-2-yl)-2-pyridinyl]amino]cyclohexyl]oxyquinoxalin-6-amine |
| SMILES | Cc1nc(NC2CCC(Oc3cc(N)cc4nccnc34)CC2)ccc1-c1nnco1 |
| InChI | InChI=1S/C22H23N7O2/c1-13-17(22-29-26-12-30-22)6-7-20(27-13)28-15-2-4-16(5-3-15)31-19-11-14(23)10-18-21(19)25-9-8-24-18/h6-12,15-16H,2-5,23H2,1H3,(H,27,28) |
| InChIKey | LZXPCIMGQUNDGU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|