C27H49O7P — CID 156673345
[(2R)-3-[3,3-dimethylbutoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 156673345) has the molecular formula C27H49O7P and a molecular weight of 516.66 g/mol. Its IUPAC name is [(2R)-3-[3,3-dimethylbutoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | [(2R)-3-[3,3-dimethylbutoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 156673345 |
| Molecular Formula | C27H49O7P |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | [(2R)-3-[3,3-dimethylbutoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OCCC(C)(C)C |
| InChI | InChI=1S/C27H49O7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26(29)32-23-25(28)24-34-35(30,31)33-22-21-27(2,3)4/h6-7,9-10,12-13,25,28H,5,8,11,14-24H2,1-4H3,(H,30,31)/b7-6-,10-9-,13-12-/t25-/m1/s1 |
| InChIKey | BNHGKVMZGOCZSU-YVHLTTHBSA-N |
| XLogP | 7.05 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|