About CID 156673457
CID 156673457 (PubChem CID 156673457) has the molecular formula C86H56B2FN10O2+2
and a molecular weight of 1302.08 g/mol.
Molecular Properties
| Compound Name | CID 156673457 |
| PubChem CID | 156673457 |
| Molecular Formula | C86H56B2FN10O2+2 |
| Molecular Weight | 1302.08 g/mol |
| Exact Mass | 1301.47 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]/C(=C(/C#N)c1ccc(N(c2ccc(-c3ccc4[n+](c3)B(F)n3c(c5cccc6cccc3c65)=N4)cc2)c2ccc(-c3ccccc3OC)cc2)cc1)c1ccc(N(c2ccc(-c3ccc4[n+](c3)[B]n3c(c5cccc6cccc3c65)=N4)cc2)c2ccc(-c3ccccc3OC)cc2)cc1 |
| InChI | InChI=1S/C86H56B2FN10O2/c1-91-84(62-34-48-70(49-35-62)97(68-44-30-58(31-45-68)72-17-5-7-23-79(72)101-3)65-38-24-55(25-39-65)63-36-50-80-92-85-73-18-8-12-60-14-10-20-76(82(60)73)98(85)87-94(80)53-63)75(52-90)59-32-46-69(47-33-59)96(67-42-28-57(29-43-67)71-16-4-6-22-78(71)100-2)66-40-26-56(27-41-66)64-37-51-81-93-86-74-19-9-13-61-15-11-21-77(83(61)74)99(86)88(89)95(81)54-64/h4-51,53-54H,2-3H3/q+2/b84-75- |
| InChIKey | SEQONFRJKRITBW-FBWBXCBQSA-N |
| XLogP | 18.66 |
| TPSA | 95.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 101 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1302.08 |
| LogP ≤ 5 | 18.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze CID 156673457 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156673457?
The IUPAC name of CID 156673457 (CID 156673457) is not available.
What is the SMILES notation for CID 156673457?
The canonical SMILES for CID 156673457 is [C-]#[N+]/C(=C(/C#N)c1ccc(N(c2ccc(-c3ccc4[n+](c3)B(F)n3c(c5cccc6cccc3c65)=N4)cc2)c2ccc(-c3ccccc3OC)cc2)cc1)c1ccc(N(c2ccc(-c3ccc4[n+](c3)[B]n3c(c5cccc6cccc3c65)=N4)cc2)c2ccc(-c3ccccc3OC)cc2)cc1.
What is the InChIKey of CID 156673457?
The InChIKey is SEQONFRJKRITBW-FBWBXCBQSA-N. The full InChI is InChI=1S/C86H56B2FN10O2/c1-91-84(62-34-48-70(49-35-62)97(68-44-30-58(31-45-68)72-17-5-7-23-79(72)101-3)65-38-24-55(25-39-65)63-36-50-80-92-85-73-18-8-12-60-14-10-20-76(82(60)73)98(85)87-94(80)53-63)75(52-90)59-32-46-69(47-33-59)96(67-42-28-57(29-43-67)71-16-4-6-22-78(71)100-2)66-40-26-56(27-41-66)64-37-51-81-93-86-74-19-9-13-61-15-11-21-77(83(61)74)99(86)88(89)95(81)54-64/h4-51,53-54H,2-3H3/q+2/b84-75-.
What are the key properties of CID 156673457?
CID 156673457 has a molecular weight of 1302.08 g/mol, XLogP of 18.66, 14 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156673457 is sourced from PubChem (CID 156673457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).