C24H50N3+3 — CID 156673508
1,1-dimethyl-3,4-bis[2-(1,1,4-trimethylpyrrolidin-1-ium-3-yl)ethyl]pyrrolidin-1-ium (PubChem CID 156673508) has the molecular formula C24H50N3+3 and a molecular weight of 380.69 g/mol. Its IUPAC name is 1,1-dimethyl-3,4-bis[2-(1,1,4-trimethylpyrrolidin-1-ium-3-yl)ethyl]pyrrolidin-1-ium.
| Compound Name | 1,1-dimethyl-3,4-bis[2-(1,1,4-trimethylpyrrolidin-1-ium-3-yl)ethyl]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 156673508 |
| Molecular Formula | C24H50N3+3 |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.40 |
| IUPAC Name | 1,1-dimethyl-3,4-bis[2-(1,1,4-trimethylpyrrolidin-1-ium-3-yl)ethyl]pyrrolidin-1-ium |
| SMILES | CC1C[N+](C)(C)CC1CCC1C[N+](C)(C)CC1CCC1C[N+](C)(C)CC1C |
| InChI | InChI=1S/C24H50N3/c1-19-13-25(3,4)15-21(19)9-11-23-17-27(7,8)18-24(23)12-10-22-16-26(5,6)14-20(22)2/h19-24H,9-18H2,1-8H3/q+3 |
| InChIKey | ABDPKMOAOPFSTN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|