About (2-methyl-5-phosphanyl-1,4-dioxan-2-yl)methanol
(2-methyl-5-phosphanyl-1,4-dioxan-2-yl)methanol (PubChem CID 156673819) has the molecular formula C6H13O3P
and a molecular weight of 164.14 g/mol. Its IUPAC name is (2-methyl-5-phosphanyl-1,4-dioxan-2-yl)methanol.
Molecular Properties
| Compound Name | (2-methyl-5-phosphanyl-1,4-dioxan-2-yl)methanol |
| PubChem CID | 156673819 |
| Molecular Formula | C6H13O3P |
| Molecular Weight | 164.14 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | (2-methyl-5-phosphanyl-1,4-dioxan-2-yl)methanol |
| SMILES | CC1(CO)COC(P)CO1 |
| InChI | InChI=1S/C6H13O3P/c1-6(3-7)4-8-5(10)2-9-6/h5,7H,2-4,10H2,1H3 |
| InChIKey | JHCJXKMILVUTJS-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.14 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-5-phosphanyl-1,4-dioxan-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-5-phosphanyl-1,4-dioxan-2-yl)methanol?
The IUPAC name of (2-methyl-5-phosphanyl-1,4-dioxan-2-yl)methanol (CID 156673819) is (2-methyl-5-phosphanyl-1,4-dioxan-2-yl)methanol.
What is the SMILES notation for (2-methyl-5-phosphanyl-1,4-dioxan-2-yl)methanol?
The canonical SMILES for (2-methyl-5-phosphanyl-1,4-dioxan-2-yl)methanol is CC1(CO)COC(P)CO1.
What is the InChIKey of (2-methyl-5-phosphanyl-1,4-dioxan-2-yl)methanol?
The InChIKey is JHCJXKMILVUTJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O3P/c1-6(3-7)4-8-5(10)2-9-6/h5,7H,2-4,10H2,1H3.
What are the key properties of (2-methyl-5-phosphanyl-1,4-dioxan-2-yl)methanol?
(2-methyl-5-phosphanyl-1,4-dioxan-2-yl)methanol has a molecular weight of 164.14 g/mol, XLogP of -0.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-5-phosphanyl-1,4-dioxan-2-yl)methanol is sourced from PubChem (CID 156673819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).