C57H41N5O3 — CID 156674141
2-[4-[2-[3,5-bis[(4-pyridin-2-ylphenoxy)methyl]phenyl]phenyl]-3-(3-pyridin-2-ylphenoxy)phenyl]pyrimidine (PubChem CID 156674141) has the molecular formula C57H41N5O3 and a molecular weight of 843.99 g/mol. Its IUPAC name is 2-[4-[2-[3,5-bis[(4-pyridin-2-ylphenoxy)methyl]phenyl]phenyl]-3-(3-pyridin-2-ylphenoxy)phenyl]pyrimidine.
| Compound Name | 2-[4-[2-[3,5-bis[(4-pyridin-2-ylphenoxy)methyl]phenyl]phenyl]-3-(3-pyridin-2-ylphenoxy)phenyl]pyrimidine |
|---|---|
| PubChem CID | 156674141 |
| Molecular Formula | C57H41N5O3 |
| Molecular Weight | 843.99 g/mol |
| Exact Mass | 843.32 |
| IUPAC Name | 2-[4-[2-[3,5-bis[(4-pyridin-2-ylphenoxy)methyl]phenyl]phenyl]-3-(3-pyridin-2-ylphenoxy)phenyl]pyrimidine |
| SMILES | c1ccc(-c2ccc(OCc3cc(COc4ccc(-c5ccccn5)cc4)cc(-c4ccccc4-c4ccc(-c5ncccn5)cc4Oc4cccc(-c5ccccn5)c4)c3)cc2)nc1 |
| InChI | InChI=1S/C57H41N5O3/c1-2-14-51(52-27-22-45(57-61-31-10-32-62-57)37-56(52)65-49-12-9-11-44(36-49)55-17-5-8-30-60-55)50(13-1)46-34-40(38-63-47-23-18-42(19-24-47)53-15-3-6-28-58-53)33-41(35-46)39-64-48-25-20-43(21-26-48)54-16-4-7-29-59-54/h1-37H,38-39H2 |
| InChIKey | LNFURBBYKCEZDR-UHFFFAOYSA-N |
| XLogP | 13.61 |
| TPSA | 92.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.99 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |