C24H32N2O2Si — CID 156674365
(4aS,8aS)-4-[tert-butyl(diphenyl)silyl]oxy-3,4,4a,5,6,7,8,8a-octahydro-1H-1,7-naphthyridin-2-one (PubChem CID 156674365) has the molecular formula C24H32N2O2Si and a molecular weight of 408.62 g/mol. Its IUPAC name is (4aS,8aS)-4-[tert-butyl(diphenyl)silyl]oxy-3,4,4a,5,6,7,8,8a-octahydro-1H-1,7-naphthyridin-2-one.
| Compound Name | (4aS,8aS)-4-[tert-butyl(diphenyl)silyl]oxy-3,4,4a,5,6,7,8,8a-octahydro-1H-1,7-naphthyridin-2-one |
|---|---|
| PubChem CID | 156674365 |
| Molecular Formula | C24H32N2O2Si |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | (4aS,8aS)-4-[tert-butyl(diphenyl)silyl]oxy-3,4,4a,5,6,7,8,8a-octahydro-1H-1,7-naphthyridin-2-one |
| SMILES | CC(C)(C)[Si](OC1CC(=O)N[C@@H]2CNCC[C@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O2Si/c1-24(2,3)29(18-10-6-4-7-11-18,19-12-8-5-9-13-19)28-22-16-23(27)26-21-17-25-15-14-20(21)22/h4-13,20-22,25H,14-17H2,1-3H3,(H,26,27)/t20-,21+,22?/m0/s1 |
| InChIKey | JOZYLYJCLNMYEF-UGGDCYSXSA-N |
| XLogP | 2.43 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|