C21H31BN2O4 — CID 156674762
tert-butyl 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 156674762) has the molecular formula C21H31BN2O4 and a molecular weight of 386.30 g/mol. Its IUPAC name is tert-butyl 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | tert-butyl 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 156674762 |
| Molecular Formula | C21H31BN2O4 |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | tert-butyl 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC2(c2ccc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C21H31BN2O4/c1-18(2,3)26-17(25)24-12-14-10-21(14,13-24)16-9-8-15(11-23-16)22-27-19(4,5)20(6,7)28-22/h8-9,11,14H,10,12-13H2,1-7H3 |
| InChIKey | OEECPWJSJPDYAN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|