C30H40Si — CID 156675178
(1,3-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-2-yl)-[2-(3,5-dimethylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane (PubChem CID 156675178) has the molecular formula C30H40Si and a molecular weight of 428.74 g/mol. Its IUPAC name is (1,3-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-2-yl)-[2-(3,5-dimethylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane.
| Compound Name | (1,3-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-2-yl)-[2-(3,5-dimethylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 156675178 |
| Molecular Formula | C30H40Si |
| Molecular Weight | 428.74 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | (1,3-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-2-yl)-[2-(3,5-dimethylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane |
| SMILES | Cc1cc(C)cc(C2CC3C=CC=CC3C2[Si](C)(C)C2C(C)C3C=CC=CC3C2C)c1 |
| InChI | InChI=1S/C30H40Si/c1-19-15-20(2)17-24(16-19)28-18-23-11-7-8-14-27(23)30(28)31(5,6)29-21(3)25-12-9-10-13-26(25)22(29)4/h7-17,21-23,25-30H,18H2,1-6H3 |
| InChIKey | IHGNRLBDOOTJNQ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.74 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|