C54H33N3O — CID 156675428
2-[4-[2'-(4-isocyanophenyl)spiro[fluorene-9,9'-xanthene]-2-yl]phenyl]-4,6-diphenylpyrimidine (PubChem CID 156675428) has the molecular formula C54H33N3O and a molecular weight of 739.88 g/mol. Its IUPAC name is 2-[4-[2'-(4-isocyanophenyl)spiro[fluorene-9,9'-xanthene]-2-yl]phenyl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[4-[2'-(4-isocyanophenyl)spiro[fluorene-9,9'-xanthene]-2-yl]phenyl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 156675428 |
| Molecular Formula | C54H33N3O |
| Molecular Weight | 739.88 g/mol |
| Exact Mass | 739.26 |
| IUPAC Name | 2-[4-[2'-(4-isocyanophenyl)spiro[fluorene-9,9'-xanthene]-2-yl]phenyl]-4,6-diphenylpyrimidine |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3c(c2)C2(c4ccccc4O3)c3ccccc3-c3ccc(-c4ccc(-c5nc(-c6ccccc6)cc(-c6ccccc6)n5)cc4)cc32)cc1 |
| InChI | InChI=1S/C54H33N3O/c1-55-42-28-24-36(25-29-42)41-27-31-52-48(33-41)54(46-18-10-11-19-51(46)58-52)45-17-9-8-16-43(45)44-30-26-40(32-47(44)54)35-20-22-39(23-21-35)53-56-49(37-12-4-2-5-13-37)34-50(57-53)38-14-6-3-7-15-38/h2-34H |
| InChIKey | DGPNRDSHLHJCOB-UHFFFAOYSA-N |
| XLogP | 13.83 |
| TPSA | 39.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.88 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|