C47H28N4O — CID 156675431
4-[6-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]spiro[fluorene-9,9'-xanthene]-4-yl]benzonitrile (PubChem CID 156675431) has the molecular formula C47H28N4O and a molecular weight of 674.83 g/mol. Its IUPAC name is 4-[6-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]spiro[fluorene-9,9'-xanthene]-4-yl]benzonitrile.
| Compound Name | 4-[6-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]spiro[fluorene-9,9'-xanthene]-4-yl]benzonitrile |
|---|---|
| PubChem CID | 156675431 |
| Molecular Formula | C47H28N4O |
| Molecular Weight | 674.83 g/mol |
| Exact Mass | 674.29 |
| IUPAC Name | 4-[6-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]spiro[fluorene-9,9'-xanthene]-4-yl]benzonitrile |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc4c(c3)-c3c(-c5ccc(C#N)cc5)cccc3C43c4ccccc4Oc4ccccc43)nc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])n2)c([2H])c1[2H] |
| InChI | InChI=1S/C47H28N4O/c48-29-30-22-24-31(25-23-30)35-16-11-19-40-43(35)36-28-34(46-50-44(32-12-3-1-4-13-32)49-45(51-46)33-14-5-2-6-15-33)26-27-37(36)47(40)38-17-7-9-20-41(38)52-42-21-10-8-18-39(42)47/h1-28H/i1D,2D,3D,4D,5D,6D,12D,13D,14D,15D |
| InChIKey | BXDDRWIBHZXFHS-RXOJMXQBSA-N |
| XLogP | 10.88 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.83 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |