C46H54GeIrNO3- — CID 156675926
(Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;trimethyl-[2-(1-methyl-3H-dibenzofuran-3-id-4-yl)-4-phenylquinolin-6-yl]germane (PubChem CID 156675926) has the molecular formula C46H54GeIrNO3- and a molecular weight of 933.77 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;trimethyl-[2-(1-methyl-3H-dibenzofuran-3-id-4-yl)-4-phenylquinolin-6-yl]germane.
| Compound Name | (Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;trimethyl-[2-(1-methyl-3H-dibenzofuran-3-id-4-yl)-4-phenylquinolin-6-yl]germane |
|---|---|
| PubChem CID | 156675926 |
| Molecular Formula | C46H54GeIrNO3- |
| Molecular Weight | 933.77 g/mol |
| Exact Mass | 935.30 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;trimethyl-[2-(1-methyl-3H-dibenzofuran-3-id-4-yl)-4-phenylquinolin-6-yl]germane |
| SMILES | CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.Cc1c[c-]c(-c2cc(-c3ccccc3)c3cc([Ge](C)(C)C)ccc3n2)c2oc3ccccc3c12.[Ir] |
| InChI | InChI=1S/C31H26GeNO.C15H28O2.Ir/c1-20-14-16-23(31-30(20)24-12-8-9-13-29(24)34-31)28-19-25(21-10-6-5-7-11-21)26-18-22(32(2,3)4)15-17-27(26)33-28;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h5-15,17-19H,1-4H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-; |
| InChIKey | HELRGBWSCRIFQL-SWPBDETKSA-N |
| XLogP | 12.77 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.77 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|