About 4-O-benzyl 1-O-tert-butyl 6-(4-fluorophenyl)sulfanyl-1,4-diazepane-1,4-dicarboxylate
4-O-benzyl 1-O-tert-butyl 6-(4-fluorophenyl)sulfanyl-1,4-diazepane-1,4-dicarboxylate (PubChem CID 156676265) has the molecular formula C24H29FN2O4S
and a molecular weight of 460.57 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl 6-(4-fluorophenyl)sulfanyl-1,4-diazepane-1,4-dicarboxylate.
Molecular Properties
| Compound Name | 4-O-benzyl 1-O-tert-butyl 6-(4-fluorophenyl)sulfanyl-1,4-diazepane-1,4-dicarboxylate |
| PubChem CID | 156676265 |
| Molecular Formula | C24H29FN2O4S |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl 6-(4-fluorophenyl)sulfanyl-1,4-diazepane-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OCc2ccccc2)CC(Sc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C24H29FN2O4S/c1-24(2,3)31-23(29)27-14-13-26(22(28)30-17-18-7-5-4-6-8-18)15-21(16-27)32-20-11-9-19(25)10-12-20/h4-12,21H,13-17H2,1-3H3 |
| InChIKey | FVROGMJBMIQYNV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-O-benzyl 1-O-tert-butyl 6-(4-fluorophenyl)sulfanyl-1,4-diazepane-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-benzyl 1-O-tert-butyl 6-(4-fluorophenyl)sulfanyl-1,4-diazepane-1,4-dicarboxylate?
The IUPAC name of 4-O-benzyl 1-O-tert-butyl 6-(4-fluorophenyl)sulfanyl-1,4-diazepane-1,4-dicarboxylate (CID 156676265) is 4-O-benzyl 1-O-tert-butyl 6-(4-fluorophenyl)sulfanyl-1,4-diazepane-1,4-dicarboxylate.
What is the SMILES notation for 4-O-benzyl 1-O-tert-butyl 6-(4-fluorophenyl)sulfanyl-1,4-diazepane-1,4-dicarboxylate?
The canonical SMILES for 4-O-benzyl 1-O-tert-butyl 6-(4-fluorophenyl)sulfanyl-1,4-diazepane-1,4-dicarboxylate is CC(C)(C)OC(=O)N1CCN(C(=O)OCc2ccccc2)CC(Sc2ccc(F)cc2)C1.
What is the InChIKey of 4-O-benzyl 1-O-tert-butyl 6-(4-fluorophenyl)sulfanyl-1,4-diazepane-1,4-dicarboxylate?
The InChIKey is FVROGMJBMIQYNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29FN2O4S/c1-24(2,3)31-23(29)27-14-13-26(22(28)30-17-18-7-5-4-6-8-18)15-21(16-27)32-20-11-9-19(25)10-12-20/h4-12,21H,13-17H2,1-3H3.
What are the key properties of 4-O-benzyl 1-O-tert-butyl 6-(4-fluorophenyl)sulfanyl-1,4-diazepane-1,4-dicarboxylate?
4-O-benzyl 1-O-tert-butyl 6-(4-fluorophenyl)sulfanyl-1,4-diazepane-1,4-dicarboxylate has a molecular weight of 460.57 g/mol, XLogP of 5.18, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-benzyl 1-O-tert-butyl 6-(4-fluorophenyl)sulfanyl-1,4-diazepane-1,4-dicarboxylate is sourced from PubChem (CID 156676265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).