C20H32O6 — CID 156676631
(3-acetyloxy-2-hept-4-enoyloxypropyl) (Z)-oct-4-enoate (PubChem CID 156676631) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is (3-acetyloxy-2-hept-4-enoyloxypropyl) (Z)-oct-4-enoate.
| Compound Name | (3-acetyloxy-2-hept-4-enoyloxypropyl) (Z)-oct-4-enoate |
|---|---|
| PubChem CID | 156676631 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (3-acetyloxy-2-hept-4-enoyloxypropyl) (Z)-oct-4-enoate |
| SMILES | CCC=CCCC(=O)OC(COC(C)=O)COC(=O)CC/C=C\CCC |
| InChI | InChI=1S/C20H32O6/c1-4-6-8-10-12-13-19(22)25-16-18(15-24-17(3)21)26-20(23)14-11-9-7-5-2/h7-10,18H,4-6,11-16H2,1-3H3/b9-7?,10-8- |
| InChIKey | NXWPWGXXCSTIRP-GJLXSVDYSA-N |
| XLogP | 3.89 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|