About 2,3-dihydroxypropyl (7E)-trideca-4,7-dienoate
2,3-dihydroxypropyl (7E)-trideca-4,7-dienoate (PubChem CID 156676635) has the molecular formula C16H28O4
and a molecular weight of 284.40 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (7E)-trideca-4,7-dienoate.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl (7E)-trideca-4,7-dienoate |
| PubChem CID | 156676635 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2,3-dihydroxypropyl (7E)-trideca-4,7-dienoate |
| SMILES | CCCCC/C=C/CC=CCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C16H28O4/c1-2-3-4-5-6-7-8-9-10-11-12-16(19)20-14-15(18)13-17/h6-7,9-10,15,17-18H,2-5,8,11-14H2,1H3/b7-6+,10-9? |
| InChIKey | KDEBRNWWOLCHBY-GVEAZXRRSA-N |
| XLogP | 2.75 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxypropyl (7E)-trideca-4,7-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl (7E)-trideca-4,7-dienoate?
The IUPAC name of 2,3-dihydroxypropyl (7E)-trideca-4,7-dienoate (CID 156676635) is 2,3-dihydroxypropyl (7E)-trideca-4,7-dienoate.
What is the SMILES notation for 2,3-dihydroxypropyl (7E)-trideca-4,7-dienoate?
The canonical SMILES for 2,3-dihydroxypropyl (7E)-trideca-4,7-dienoate is CCCCC/C=C/CC=CCCC(=O)OCC(O)CO.
What is the InChIKey of 2,3-dihydroxypropyl (7E)-trideca-4,7-dienoate?
The InChIKey is KDEBRNWWOLCHBY-GVEAZXRRSA-N. The full InChI is InChI=1S/C16H28O4/c1-2-3-4-5-6-7-8-9-10-11-12-16(19)20-14-15(18)13-17/h6-7,9-10,15,17-18H,2-5,8,11-14H2,1H3/b7-6+,10-9?.
What are the key properties of 2,3-dihydroxypropyl (7E)-trideca-4,7-dienoate?
2,3-dihydroxypropyl (7E)-trideca-4,7-dienoate has a molecular weight of 284.40 g/mol, XLogP of 2.75, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl (7E)-trideca-4,7-dienoate is sourced from PubChem (CID 156676635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).