About 5H-imidazo[1,2-a]quinoxalin-4-one
5H-imidazo[1,2-a]quinoxalin-4-one (PubChem CID 15667665) has the molecular formula C10H7N3O
and a molecular weight of 185.19 g/mol. Its IUPAC name is 5H-imidazo[1,2-a]quinoxalin-4-one.
Molecular Properties
| Compound Name | 5H-imidazo[1,2-a]quinoxalin-4-one |
| PubChem CID | 15667665 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 5H-imidazo[1,2-a]quinoxalin-4-one |
| SMILES | O=c1[nH]c2ccccc2n2ccnc12 |
| InChI | InChI=1S/C10H7N3O/c14-10-9-11-5-6-13(9)8-4-2-1-3-7(8)12-10/h1-6H,(H,12,14) |
| InChIKey | YTEOFXCKOQBQRA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-imidazo[1,2-a]quinoxalin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-imidazo[1,2-a]quinoxalin-4-one?
The IUPAC name of 5H-imidazo[1,2-a]quinoxalin-4-one (CID 15667665) is 5H-imidazo[1,2-a]quinoxalin-4-one.
What is the SMILES notation for 5H-imidazo[1,2-a]quinoxalin-4-one?
The canonical SMILES for 5H-imidazo[1,2-a]quinoxalin-4-one is O=c1[nH]c2ccccc2n2ccnc12.
What is the InChIKey of 5H-imidazo[1,2-a]quinoxalin-4-one?
The InChIKey is YTEOFXCKOQBQRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O/c14-10-9-11-5-6-13(9)8-4-2-1-3-7(8)12-10/h1-6H,(H,12,14).
What are the key properties of 5H-imidazo[1,2-a]quinoxalin-4-one?
5H-imidazo[1,2-a]quinoxalin-4-one has a molecular weight of 185.19 g/mol, XLogP of 1.18, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-imidazo[1,2-a]quinoxalin-4-one is sourced from PubChem (CID 15667665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).