C17H11Cl2N9O3 — CID 156676770
2-[3,5-dichloro-4-(8-propan-2-yltetrazolo[1,5-b]pyridazin-6-yl)oxyphenyl]-6-isocyano-1,2,4-triazine-3,5-dione (PubChem CID 156676770) has the molecular formula C17H11Cl2N9O3 and a molecular weight of 460.24 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-(8-propan-2-yltetrazolo[1,5-b]pyridazin-6-yl)oxyphenyl]-6-isocyano-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-(8-propan-2-yltetrazolo[1,5-b]pyridazin-6-yl)oxyphenyl]-6-isocyano-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 156676770 |
| Molecular Formula | C17H11Cl2N9O3 |
| Molecular Weight | 460.24 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | 2-[3,5-dichloro-4-(8-propan-2-yltetrazolo[1,5-b]pyridazin-6-yl)oxyphenyl]-6-isocyano-1,2,4-triazine-3,5-dione |
| SMILES | [C-]#[N+]c1nn(-c2cc(Cl)c(Oc3cc(C(C)C)c4nnnn4n3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H11Cl2N9O3/c1-7(2)9-6-12(23-28-15(9)22-25-26-28)31-13-10(18)4-8(5-11(13)19)27-17(30)21-16(29)14(20-3)24-27/h4-7H,1-2H3,(H,21,29,30) |
| InChIKey | AGHDXXBTAGNMJV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|