About CID 156677015
CID 156677015 (PubChem CID 156677015) has the molecular formula C40H37F3IrN3O2-
and a molecular weight of 840.97 g/mol.
Molecular Properties
| Compound Name | CID 156677015 |
| PubChem CID | 156677015 |
| Molecular Formula | C40H37F3IrN3O2- |
| Molecular Weight | 840.97 g/mol |
| Exact Mass | 841.25 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.FC(F)(F)c1c2ccccc2cc2c(-c3[c-]n4c5ccccc5c5cccc3c54)ncnc12.[Ir] |
| InChI | InChI=1S/C27H13F3N3.C13H24O2.Ir/c28-27(29,30)23-16-7-2-1-6-15(16)12-20-24(31-14-32-25(20)23)21-13-33-22-11-4-3-8-17(22)18-9-5-10-19(21)26(18)33;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-12,14H;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | UFITZDMBQJRGIP-DZTQYQPZSA-N |
| XLogP | 11.13 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 840.97 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze CID 156677015 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156677015?
The IUPAC name of CID 156677015 (CID 156677015) is not available.
What is the SMILES notation for CID 156677015?
The canonical SMILES for CID 156677015 is CCC(CC)C(=O)/C=C(\O)C(CC)CC.FC(F)(F)c1c2ccccc2cc2c(-c3[c-]n4c5ccccc5c5cccc3c54)ncnc12.[Ir].
What is the InChIKey of CID 156677015?
The InChIKey is UFITZDMBQJRGIP-DZTQYQPZSA-N. The full InChI is InChI=1S/C27H13F3N3.C13H24O2.Ir/c28-27(29,30)23-16-7-2-1-6-15(16)12-20-24(31-14-32-25(20)23)21-13-33-22-11-4-3-8-17(22)18-9-5-10-19(21)26(18)33;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-12,14H;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;.
What are the key properties of CID 156677015?
CID 156677015 has a molecular weight of 840.97 g/mol, XLogP of 11.13, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156677015 is sourced from PubChem (CID 156677015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).