About [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 3-(4-methylphenyl)propanoate
[2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 3-(4-methylphenyl)propanoate (PubChem CID 156677156) has the molecular formula C20H26O3
and a molecular weight of 314.42 g/mol. Its IUPAC name is [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 3-(4-methylphenyl)propanoate.
Molecular Properties
| Compound Name | [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 3-(4-methylphenyl)propanoate |
| PubChem CID | 156677156 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 3-(4-methylphenyl)propanoate |
| SMILES | Cc1ccc(CCC(=O)OCC(=O)[C@]2(C)CC=CC2(C)C)cc1 |
| InChI | InChI=1S/C20H26O3/c1-15-6-8-16(9-7-15)10-11-18(22)23-14-17(21)20(4)13-5-12-19(20,2)3/h5-9,12H,10-11,13-14H2,1-4H3/t20-/m0/s1 |
| InChIKey | JQBBQSCKRQFLIA-FQEVSTJZSA-N |
| XLogP | 4.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 3-(4-methylphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 3-(4-methylphenyl)propanoate?
The IUPAC name of [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 3-(4-methylphenyl)propanoate (CID 156677156) is [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 3-(4-methylphenyl)propanoate.
What is the SMILES notation for [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 3-(4-methylphenyl)propanoate?
The canonical SMILES for [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 3-(4-methylphenyl)propanoate is Cc1ccc(CCC(=O)OCC(=O)[C@]2(C)CC=CC2(C)C)cc1.
What is the InChIKey of [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 3-(4-methylphenyl)propanoate?
The InChIKey is JQBBQSCKRQFLIA-FQEVSTJZSA-N. The full InChI is InChI=1S/C20H26O3/c1-15-6-8-16(9-7-15)10-11-18(22)23-14-17(21)20(4)13-5-12-19(20,2)3/h5-9,12H,10-11,13-14H2,1-4H3/t20-/m0/s1.
What are the key properties of [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 3-(4-methylphenyl)propanoate?
[2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 3-(4-methylphenyl)propanoate has a molecular weight of 314.42 g/mol, XLogP of 4.03, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 3-(4-methylphenyl)propanoate is sourced from PubChem (CID 156677156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).