About 3-(2-phenoxyphenoxy)benzene-1,2-dicarbonitrile
3-(2-phenoxyphenoxy)benzene-1,2-dicarbonitrile (PubChem CID 15667741) has the molecular formula C20H12N2O2
and a molecular weight of 312.33 g/mol. Its IUPAC name is 3-(2-phenoxyphenoxy)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 3-(2-phenoxyphenoxy)benzene-1,2-dicarbonitrile |
| PubChem CID | 15667741 |
| Molecular Formula | C20H12N2O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 3-(2-phenoxyphenoxy)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cccc(Oc2ccccc2Oc2ccccc2)c1C#N |
| InChI | InChI=1S/C20H12N2O2/c21-13-15-7-6-12-18(17(15)14-22)24-20-11-5-4-10-19(20)23-16-8-2-1-3-9-16/h1-12H |
| InChIKey | ZUTVCEDMZQFZBT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-phenoxyphenoxy)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-phenoxyphenoxy)benzene-1,2-dicarbonitrile?
The IUPAC name of 3-(2-phenoxyphenoxy)benzene-1,2-dicarbonitrile (CID 15667741) is 3-(2-phenoxyphenoxy)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 3-(2-phenoxyphenoxy)benzene-1,2-dicarbonitrile?
The canonical SMILES for 3-(2-phenoxyphenoxy)benzene-1,2-dicarbonitrile is N#Cc1cccc(Oc2ccccc2Oc2ccccc2)c1C#N.
What is the InChIKey of 3-(2-phenoxyphenoxy)benzene-1,2-dicarbonitrile?
The InChIKey is ZUTVCEDMZQFZBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12N2O2/c21-13-15-7-6-12-18(17(15)14-22)24-20-11-5-4-10-19(20)23-16-8-2-1-3-9-16/h1-12H.
What are the key properties of 3-(2-phenoxyphenoxy)benzene-1,2-dicarbonitrile?
3-(2-phenoxyphenoxy)benzene-1,2-dicarbonitrile has a molecular weight of 312.33 g/mol, XLogP of 5.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-phenoxyphenoxy)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 15667741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).