C60H56N3OPtS- — CID 156677778
2,4-ditert-butyl-6-[4-(1-isoquinolin-1-yl-2H-dibenzothiophen-2-id-3-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]phenol;platinum (PubChem CID 156677778) has the molecular formula C60H56N3OPtS- and a molecular weight of 1062.27 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-(1-isoquinolin-1-yl-2H-dibenzothiophen-2-id-3-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[4-(1-isoquinolin-1-yl-2H-dibenzothiophen-2-id-3-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 156677778 |
| Molecular Formula | C60H56N3OPtS- |
| Molecular Weight | 1062.27 g/mol |
| Exact Mass | 1061.38 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-(1-isoquinolin-1-yl-2H-dibenzothiophen-2-id-3-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)nc2c(-c3[c-]c(-c4nccc5ccccc45)c4c(c3)sc3ccccc34)cccc21.[Pt] |
| InChI | InChI=1S/C60H56N3OS.Pt/c1-35(2)45-29-39(37-19-12-11-13-20-37)30-46(36(3)4)56(45)63-50-25-18-24-43(55(50)62-58(63)48-33-41(59(5,6)7)34-49(57(48)64)60(8,9)10)40-31-47(54-42-22-15-14-21-38(42)27-28-61-54)53-44-23-16-17-26-51(44)65-52(53)32-40;/h11-30,32-36,64H,1-10H3;/q-1; |
| InChIKey | USNOCXIZTHZVQJ-UHFFFAOYSA-N |
| XLogP | 16.95 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1062.27 |
| LogP ≤ 5 | 16.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|