C24H27F3N6O3 — CID 156678189
(E)-3-amino-N-[(2R)-2-(hydroxymethyl)-2-methyl-6-[(1S,4S)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3H-1-benzofuran-5-yl]-2-pyrimidin-2-ylprop-2-enamide (PubChem CID 156678189) has the molecular formula C24H27F3N6O3 and a molecular weight of 504.51 g/mol. Its IUPAC name is (E)-3-amino-N-[(2R)-2-(hydroxymethyl)-2-methyl-6-[(1S,4S)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3H-1-benzofuran-5-yl]-2-pyrimidin-2-ylprop-2-enamide.
| Compound Name | (E)-3-amino-N-[(2R)-2-(hydroxymethyl)-2-methyl-6-[(1S,4S)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3H-1-benzofuran-5-yl]-2-pyrimidin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 156678189 |
| Molecular Formula | C24H27F3N6O3 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | (E)-3-amino-N-[(2R)-2-(hydroxymethyl)-2-methyl-6-[(1S,4S)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3H-1-benzofuran-5-yl]-2-pyrimidin-2-ylprop-2-enamide |
| SMILES | C[C@]1(CO)Cc2cc(NC(=O)/C(=C/N)c3ncccn3)c(N3C[C@@H]4C[C@H]3CN4CC(F)(F)F)cc2O1 |
| InChI | InChI=1S/C24H27F3N6O3/c1-23(13-34)8-14-5-18(31-22(35)17(9-28)21-29-3-2-4-30-21)19(7-20(14)36-23)33-11-15-6-16(33)10-32(15)12-24(25,26)27/h2-5,7,9,15-16,34H,6,8,10-13,28H2,1H3,(H,31,35)/b17-9+/t15-,16-,23+/m0/s1 |
| InChIKey | NPDLNNYVIQKXHY-YCJQRYMDSA-N |
| XLogP | 1.93 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|