C26H36ClFN4O3Si — CID 156678295
1-[5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-4-methyl-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 156678295) has the molecular formula C26H36ClFN4O3Si and a molecular weight of 535.14 g/mol. Its IUPAC name is 1-[5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-4-methyl-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-[5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-4-methyl-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156678295 |
| Molecular Formula | C26H36ClFN4O3Si |
| Molecular Weight | 535.14 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 1-[5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-4-methyl-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1c(CCCCO[Si](C)(C)C(C)(C)C)cnc(C(C)C)c1-n1c(=O)[nH]c(=O)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C26H36ClFN4O3Si/c1-15(2)20-21(32-23-18(24(33)31-25(32)34)13-19(28)22(27)30-23)16(3)17(14-29-20)11-9-10-12-35-36(7,8)26(4,5)6/h13-15H,9-12H2,1-8H3,(H,31,33,34) |
| InChIKey | LSCKPDLDHRKLGJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.14 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|