C24H32ClFN4O3Si — CID 156678308
1-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 156678308) has the molecular formula C24H32ClFN4O3Si and a molecular weight of 507.08 g/mol. Its IUPAC name is 1-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156678308 |
| Molecular Formula | C24H32ClFN4O3Si |
| Molecular Weight | 507.08 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 1-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CC(C)c1nccc(CCCO[Si](C)(C)C(C)(C)C)c1-n1c(=O)[nH]c(=O)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C24H32ClFN4O3Si/c1-14(2)18-19(15(10-11-27-18)9-8-12-33-34(6,7)24(3,4)5)30-21-16(22(31)29-23(30)32)13-17(26)20(25)28-21/h10-11,13-14H,8-9,12H2,1-7H3,(H,29,31,32) |
| InChIKey | YRVYPTKRBBFZRV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.08 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|