C34H50ClFN6O5Si — CID 156678327
tert-butyl (3S)-4-[1-[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoro-2-oxopyrido[2,3-d]pyrimidin-4-yl]-3-methylpiperazine-1-carboxylate (PubChem CID 156678327) has the molecular formula C34H50ClFN6O5Si and a molecular weight of 705.35 g/mol. Its IUPAC name is tert-butyl (3S)-4-[1-[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoro-2-oxopyrido[2,3-d]pyrimidin-4-yl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-[1-[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoro-2-oxopyrido[2,3-d]pyrimidin-4-yl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 156678327 |
| Molecular Formula | C34H50ClFN6O5Si |
| Molecular Weight | 705.35 g/mol |
| Exact Mass | 704.33 |
| IUPAC Name | tert-butyl (3S)-4-[1-[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoro-2-oxopyrido[2,3-d]pyrimidin-4-yl]-3-methylpiperazine-1-carboxylate |
| SMILES | CC(C)c1nccc(OCCCO[Si](C)(C)C(C)(C)C)c1-n1c(=O)nc(N2CCN(C(=O)OC(C)(C)C)C[C@@H]2C)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C34H50ClFN6O5Si/c1-21(2)26-27(25(13-14-37-26)45-17-12-18-46-48(10,11)34(7,8)9)42-30-23(19-24(36)28(35)38-30)29(39-31(42)43)41-16-15-40(20-22(41)3)32(44)47-33(4,5)6/h13-14,19,21-22H,12,15-18,20H2,1-11H3/t22-/m0/s1 |
| InChIKey | VJNUCNYNHHJUPK-QFIPXVFZSA-N |
| XLogP | 7.33 |
| TPSA | 111.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.35 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|