C25H34ClFN4O3Si — CID 156678346
1-[4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 156678346) has the molecular formula C25H34ClFN4O3Si and a molecular weight of 521.11 g/mol. Its IUPAC name is 1-[4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-[4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156678346 |
| Molecular Formula | C25H34ClFN4O3Si |
| Molecular Weight | 521.11 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 1-[4-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CC(C)c1nccc(CCCCO[Si](C)(C)C(C)(C)C)c1-n1c(=O)[nH]c(=O)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C25H34ClFN4O3Si/c1-15(2)19-20(31-22-17(23(32)30-24(31)33)14-18(27)21(26)29-22)16(11-12-28-19)10-8-9-13-34-35(6,7)25(3,4)5/h11-12,14-15H,8-10,13H2,1-7H3,(H,30,32,33) |
| InChIKey | RURBXQDCGYOJDT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.11 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|