C23H30ClFN4O3Si — CID 156678359
1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 156678359) has the molecular formula C23H30ClFN4O3Si and a molecular weight of 493.06 g/mol. Its IUPAC name is 1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156678359 |
| Molecular Formula | C23H30ClFN4O3Si |
| Molecular Weight | 493.06 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-propan-2-yl-3-pyridinyl]-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CC(C)c1nccc(CCO[Si](C)(C)C(C)(C)C)c1-n1c(=O)[nH]c(=O)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C23H30ClFN4O3Si/c1-13(2)17-18(14(8-10-26-17)9-11-32-33(6,7)23(3,4)5)29-20-15(21(30)28-22(29)31)12-16(25)19(24)27-20/h8,10,12-13H,9,11H2,1-7H3,(H,28,30,31) |
| InChIKey | DBLBSMUNUVALRZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.06 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|