C23H24O7 — CID 15667963
20-phenyl-2,5,8,11,14,17-hexaoxatricyclo[13.8.0.016,21]tricosa-1(15),16(21),19,22-tetraen-18-one (PubChem CID 15667963) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is 20-phenyl-2,5,8,11,14,17-hexaoxatricyclo[13.8.0.016,21]tricosa-1(15),16(21),19,22-tetraen-18-one.
| Compound Name | 20-phenyl-2,5,8,11,14,17-hexaoxatricyclo[13.8.0.016,21]tricosa-1(15),16(21),19,22-tetraen-18-one |
|---|---|
| PubChem CID | 15667963 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 20-phenyl-2,5,8,11,14,17-hexaoxatricyclo[13.8.0.016,21]tricosa-1(15),16(21),19,22-tetraen-18-one |
| SMILES | O=c1cc(-c2ccccc2)c2ccc3c(c2o1)OCCOCCOCCOCCO3 |
| InChI | InChI=1S/C23H24O7/c24-21-16-19(17-4-2-1-3-5-17)18-6-7-20-23(22(18)30-21)29-15-13-27-11-9-25-8-10-26-12-14-28-20/h1-7,16H,8-15H2 |
| InChIKey | YPZAFGSQBUQGEJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|