C19H30Si — CID 156679715
[(4Z,7Z,10Z,13Z)-3,3,6,6,9,9,12,12,15,15-decadeuteriohexadeca-4,7,10,13-tetraen-1-ynyl]-trimethylsilane (PubChem CID 156679715) has the molecular formula C19H30Si and a molecular weight of 296.60 g/mol. Its IUPAC name is [(4Z,7Z,10Z,13Z)-3,3,6,6,9,9,12,12,15,15-decadeuteriohexadeca-4,7,10,13-tetraen-1-ynyl]-trimethylsilane.
| Compound Name | [(4Z,7Z,10Z,13Z)-3,3,6,6,9,9,12,12,15,15-decadeuteriohexadeca-4,7,10,13-tetraen-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 156679715 |
| Molecular Formula | C19H30Si |
| Molecular Weight | 296.60 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | [(4Z,7Z,10Z,13Z)-3,3,6,6,9,9,12,12,15,15-decadeuteriohexadeca-4,7,10,13-tetraen-1-ynyl]-trimethylsilane |
| SMILES | [2H]C([2H])(C)/C=C\C([2H])([2H])/C=C\C([2H])([2H])/C=C\C([2H])([2H])/C=C\C([2H])([2H])C#C[Si](C)(C)C |
| InChI | InChI=1S/C19H30Si/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2,3)4/h6-7,9-10,12-13,15-16H,5,8,11,14,17H2,1-4H3/b7-6-,10-9-,13-12-,16-15-/i5D2,8D2,11D2,14D2,17D2 |
| InChIKey | QIBKNGWPHZJTTM-HUCDKZRJSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.60 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|