C16H26Si — CID 156679875
trimethyl-[(4Z,7Z,10Z)-trideca-4,7,10-trien-1-ynyl]silane (PubChem CID 156679875) has the molecular formula C16H26Si and a molecular weight of 246.47 g/mol. Its IUPAC name is trimethyl-[(4Z,7Z,10Z)-trideca-4,7,10-trien-1-ynyl]silane.
| Compound Name | trimethyl-[(4Z,7Z,10Z)-trideca-4,7,10-trien-1-ynyl]silane |
|---|---|
| PubChem CID | 156679875 |
| Molecular Formula | C16H26Si |
| Molecular Weight | 246.47 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | trimethyl-[(4Z,7Z,10Z)-trideca-4,7,10-trien-1-ynyl]silane |
| SMILES | CC/C=C\C/C=C\C/C=C\CC#C[Si](C)(C)C |
| InChI | InChI=1S/C16H26Si/c1-5-6-7-8-9-10-11-12-13-14-15-16-17(2,3)4/h6-7,9-10,12-13H,5,8,11,14H2,1-4H3/b7-6-,10-9-,13-12- |
| InChIKey | LUEKLRNYCKTBRM-QNEBEIHSSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|