C15H21BN4O2 — CID 156679997
[7-[1-(2-methoxyethyl)triazol-4-yl]-3,4-dihydro-1H-isoquinolin-2-yl]-methylborinic acid (PubChem CID 156679997) has the molecular formula C15H21BN4O2 and a molecular weight of 300.17 g/mol. Its IUPAC name is [7-[1-(2-methoxyethyl)triazol-4-yl]-3,4-dihydro-1H-isoquinolin-2-yl]-methylborinic acid.
| Compound Name | [7-[1-(2-methoxyethyl)triazol-4-yl]-3,4-dihydro-1H-isoquinolin-2-yl]-methylborinic acid |
|---|---|
| PubChem CID | 156679997 |
| Molecular Formula | C15H21BN4O2 |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | [7-[1-(2-methoxyethyl)triazol-4-yl]-3,4-dihydro-1H-isoquinolin-2-yl]-methylborinic acid |
| SMILES | COCCn1cc(-c2ccc3c(c2)CN(B(C)O)CC3)nn1 |
| InChI | InChI=1S/C15H21BN4O2/c1-16(21)19-6-5-12-3-4-13(9-14(12)10-19)15-11-20(18-17-15)7-8-22-2/h3-4,9,11,21H,5-8,10H2,1-2H3 |
| InChIKey | AKYPVOGSFBCRJX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|