C22H37FO2Si — CID 156680573
(3R,5R,8R,9R,10S,13S,14S,16R)-16-fluoro-3,13-dimethyl-3-trimethylsilyloxy-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 156680573) has the molecular formula C22H37FO2Si and a molecular weight of 380.62 g/mol. Its IUPAC name is (3R,5R,8R,9R,10S,13S,14S,16R)-16-fluoro-3,13-dimethyl-3-trimethylsilyloxy-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,5R,8R,9R,10S,13S,14S,16R)-16-fluoro-3,13-dimethyl-3-trimethylsilyloxy-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 156680573 |
| Molecular Formula | C22H37FO2Si |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | (3R,5R,8R,9R,10S,13S,14S,16R)-16-fluoro-3,13-dimethyl-3-trimethylsilyloxy-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)[C@H](F)C[C@@H]32)C1 |
| InChI | InChI=1S/C22H37FO2Si/c1-21(25-26(3,4)5)10-8-15-14(13-21)6-7-17-16(15)9-11-22(2)18(17)12-19(23)20(22)24/h14-19H,6-13H2,1-5H3/t14-,15+,16-,17-,18+,19-,21-,22+/m1/s1 |
| InChIKey | QYFUVQMPRACUSJ-WMCSDWRFSA-N |
| XLogP | 5.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|